| Drug General Information |
| Drug ID |
D0C4FT
|
| Former ID |
DNC012734
|
| Drug Name |
HEXESTROL
|
| Drug Type |
Small molecular drug
|
| Indication |
Irregularities [ICD10:N92.6]
|
Withdrawn from market |
[1],
[2],
[3]
|
|---|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C18H22O2
|
| InChI |
InChI=1S/C18H22O2/c1-3-17(13-5-9-15(19)10-6-13)18(4-2)14-7-11-16(20)12-8-14/h5-12,17-20H,3-4H2,1-2H3
|
| InChIKey |
PBBGSZCBWVPOOL-UHFFFAOYSA-N
|
| PubChem Compound ID |
|
| PubChem Substance ID |
132444, 585165, 4911068, 7848704, 8149594, 8152274, 10321181, 11335618, 11360857, 11363381, 11365943, 11368505, 11371839, 11374082, 11376667, 11461829, 11466727, 11467847, 11484438, 11486514, 11488707, 11490376, 11492207, 11494301, 15021416, 24870032, 24895805, 26611989, 26679915, 26748324, 26748325, 26748326, 29222732, 47515262, 47515263, 47736417, 47959676, 47959677, 47959678, 48035049, 48334431, 49698746, 50005371, 50064915, 50107374, 50107375, 53789301, 56463535, 57321892, 57650765
|
| Target and Pathway |
| Target(s) |
Estrogen receptor |
Target Info |
Inhibitor |
[4]
|
|---|
| Estrogen receptor beta |
Target Info |
Inhibitor |
[4]
|
|
KEGG Pathway
|
Estrogen signaling pathway
|
|
Prolactin signaling pathway
|
|
Thyroid hormone signaling pathway
|
|
Endocrine and other factor-regulated calcium reabsorption
|
|
Proteoglycans in cancerhsa04915:Estrogen signaling pathway
|
|
NetPath Pathway
|
FSH Signaling Pathway
|
|
EGFR1 Signaling Pathway
|
|
RANKL Signaling Pathway
|
|
Pathway Interaction Database
|
Regulation of nuclear SMAD2/3 signaling
|
|
Signaling events mediated by HDAC Class II
|
|
Plasma membrane estrogen receptor signaling
|
|
LKB1 signaling events
|
|
Regulation of Telomerase
|
|
ATF-2 transcription factor network
|
|
AP-1 transcription factor network
|
|
FOXM1 transcription factor network
|
|
Validated nuclear estrogen receptor alpha network
|
|
Signaling mediated by p38-alpha and p38-beta
|
|
FOXA1 transcription factor networker_nongenomic_pathway:Plasma membrane estrogen receptor signaling
|
|
Validated nuclear estrogen receptor beta network
|
|
Reactome
|
Nuclear signaling by ERBB4
|
|
Nuclear Receptor transcription pathwayR-HSA-383280:Nuclear Receptor transcription pathway
|
|
WikiPathways
|
Estrogen signaling pathway
|
|
Nuclear Receptors Meta-Pathway
|
|
Estrogen Receptor Pathway
|
|
Signaling by ERBB4
|
|
JAK/STAT
|
|
Integrated Pancreatic Cancer Pathway
|
|
Leptin signaling pathway
|
|
miR-targeted genes in muscle cell - TarBase
|
|
Integrated Breast Cancer Pathway
|
|
Nuclear ReceptorsWP706:SIDS Susceptibility Pathways
|
|
Ovarian Infertility Genes
|
|
Nuclear Receptors
|
| References |
| REF 1 | Carcinogenicity and metabolic activation of hexestrol. Chem Biol Interact. 1985 Oct;55(1-2):157-76. |
|---|
| REF 2 | Comparison of the ligand binding specificity and transcript tissue distribution of estrogen receptors alpha and beta. Endocrinology. 1997 Mar;138(3):863-70. |
|---|
| REF 3 | (http://www.guidetopharmacology.org/) Nucleic Acids Res. 2015 Oct 12. pii: gkv1037. The IUPHAR/BPS Guide to PHARMACOLOGY in 2016: towards curated quantitative interactions between 1300 protein targets and 6000 ligands. (Ligand id: 2823). |
|---|
| REF 4 | Bone targeted drugs 2. synthesis of estrogens with hydroxyapatite affinity, Bioorg. Med. Chem. Lett. 6(9):1047-1050 (1996). |
|---|
