| Drug General Information |
| Drug ID |
D0A7FQ
|
| Former ID |
DNC009913
|
| Drug Name |
CGP-57380
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C11H9FN6
|
| InChI |
InChI=1S/C11H9FN6/c12-6-1-3-7(4-2-6)16-11-8-9(13)14-5-15-10(8)17-18-11/h1-5H,(H4,13,14,15,16,17,18)
|
| InChIKey |
UQPMANVRZYYQMD-UHFFFAOYSA-N
|
| PubChem Compound ID |
|
| PubChem Substance ID |
16747733, 24724432, 26755726, 26759139, 50111280, 53800676, 56459389, 57376956, 80182634, 85787679, 90340880, 91146247, 93580909, 98577757, 99302780, 104139754, 121361998, 121502913, 123088148, 123105546, 125333931, 126700079, 135293020, 135698461, 138753860, 141444807, 162023548, 162248028, 163565210, 163687710, 172659616, 175607498, 178102632, 179694529, 180387049, 182111932, 184525797, 184525815, 184525833, 184525852, 208264893, 223398381, 227243988, 241376098, 244223337, 247192106, 252156746, 252160297, 252457400, 252471053
|
| Target and Pathway |
| Target(s) |
mRNA of Aurora B |
Target Info |
Inhibitor |
[2]
|
|---|
| Serine/threonine-protein kinase Sgk1 |
Target Info |
Inhibitor |
[2]
|
| Lck tyrosine kinase |
Target Info |
Inhibitor |
[2]
|
|
KEGG Pathway
|
FoxO signaling pathway
|
|
PI3K-Akt signaling pathway
|
|
Aldosterone-regulated sodium reabsorptionhsa04064:NF-kappa B signaling pathway
|
|
Osteoclast differentiation
|
|
Natural killer cell mediated cytotoxicity
|
|
T cell receptor signaling pathway
|
|
HTLV-I infection
|
|
Primary immunodeficiency
|
|
NetPath Pathway
|
IL5 Signaling Pathway
|
|
FSH Signaling Pathway
|
|
IL2 Signaling PathwayNetPath_11:TCR Signaling Pathway
|
|
IL2 Signaling Pathway
|
|
PANTHER Pathway
|
Parkinson disease
|
|
T cell activation
|
|
Pathway Interaction Database
|
Aurora B signaling
|
|
Signaling by Aurora kinases
|
|
Aurora C signaling
|
|
FOXM1 transcription factor network
|
|
Aurora A signalinginsulin_pathway:Insulin Pathway
|
|
Glucocorticoid receptor regulatory network
|
|
mTOR signaling pathway
|
|
FoxO family signaling
|
|
Class I PI3K signaling eventsnfkappabatypicalpathway:Atypical NF-kappaB pathway
|
|
Glypican 1 network
|
|
TCR signaling in naï
|
|
Signaling events mediated by PTP1B
|
|
IL12-mediated signaling events
|
|
Regulation of p38-alpha and p38-beta
|
|
TCR signaling in naï
|
|
Thromboxane A2 receptor signaling
|
|
SHP2 signaling
|
|
IL2-mediated signaling events
|
|
CXCR4-mediated signaling events
|
|
Class I PI3K signaling events
|
|
IL2 signaling events mediated by PI3K
|
|
amb2 Integrin signaling
|
|
EPHA forward signaling
|
|
PDGFR-beta signaling pathway
|
|
IL2 signaling events mediated by STAT5
|
|
Ephrin B reverse signaling
|
|
Alpha-synuclein signaling
|
|
Reactome
|
APC/C:Cdh1 mediated degradation of Cdc20 and other APC/C:Cdh1 targeted proteins in late mitosis/early G1
|
|
Separation of Sister Chromatids
|
|
Resolution of Sister Chromatid Cohesion
|
|
RHO GTPases Activate Formins
|
|
Mitotic PrometaphaseR-HSA-2672351:Stimuli-sensing channelsR-HSA-114604:GPVI-mediated activation cascade
|
|
PIP3 activates AKT signaling
|
|
Regulation of KIT signaling
|
|
Phosphorylation of CD3 and TCR zeta chains
|
|
Translocation of ZAP-70 to Immunological synapse
|
|
Generation of second messenger molecules
|
|
PECAM1 interactions
|
|
Constitutive Signaling by Aberrant PI3K in Cancer
|
|
DAP12 signaling
|
|
CD28 co-stimulation
|
|
CD28 dependent PI3K/Akt signaling
|
|
CD28 dependent Vav1 pathway
|
|
CTLA4 inhibitory signaling
|
|
PD-1 signaling
|
|
Interleukin-2 signaling
|
|
WikiPathways
|
Mitotic Metaphase and Anaphase
|
|
Mitotic Prometaphase
|
|
Regulation of Microtubule Cytoskeleton
|
|
miR-targeted genes in lymphocytes - TarBase
|
|
miR-targeted genes in epithelium - TarBase
|
|
APC/C-mediated degradation of cell cycle proteinsWP481:Insulin Signaling
|
|
Iron uptake and transport
|
|
FSH signaling pathwayWP61:Notch Signaling Pathway
|
|
Interferon type I signaling pathways
|
|
IL-2 Signaling Pathway
|
|
Inflammatory Response Pathway
|
|
Signaling by SCF-KIT
|
|
DAP12 interactions
|
|
Host Interactions of HIV factors
|
|
PIP3 activates AKT signaling
|
|
T-Cell Receptor and Co-stimulatory Signaling
|
|
B Cell Receptor Signaling Pathway
|
|
TSLP Signaling Pathway
|
|
TCR signaling
|
|
Costimulation by the CD28 family
|
| References |
| REF 1 | (http://www.guidetopharmacology.org/) Nucleic Acids Res. 2015 Oct 12. pii: gkv1037. The IUPHAR/BPS Guide to PHARMACOLOGY in 2016: towards curated quantitative interactions between 1300 protein targets and 6000 ligands. (Ligand id: 6010). |
|---|
| REF 2 | Biochem J. 2007 Dec 15;408(3):297-315.The selectivity of protein kinase inhibitors: a further update. |
|---|
