| Drug General Information |
| Drug ID |
D09WKB
|
| Former ID |
DAP001274
|
| Drug Name |
Anisindione
|
| Synonyms |
Anisindiona; Anisindionum; Miradon; Unidone; Anisin indandione; SPE 2792; Anisindiona [INN-Spanish]; Anisindione (INN); Anisindione [INN:BAN]; Anisindionum [INN-Latin]; Miradon (TN); 2-(4-Methoxy-phenyl)-indan-1,3-dione; 2-(4-Methoxyphenyl)-1H-indene-1,3(2H)-dione; 2-(4-Methoxyphenyl)indan-1,3-dione; 2-(4-methoxyphenyl)indene-1,3-dione; 2-(p-Methoxyphenyl)-1,3-indandione; 2-(p-Methoxyphenyl)indane-1,3-dione; 2-[4-(methyloxy)phenyl]-1H-indene-1,3(2H)-dione; 2-p-Anisyl-1,3-indandione; 2-para-Anisyl-1,3-indandione
|
| Drug Type |
Small molecular drug
|
| Indication |
Coagulation [ICD10:I80-I82]
|
Approved |
[1],
[2]
|
|---|
| Therapeutic Class |
Anticoagulants
|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C16H12O3
|
| InChI |
InChI=1S/C16H12O3/c1-19-11-8-6-10(7-9-11)14-15(17)12-4-2-3-5-13(12)16(14)18/h2-9,14H,1H3
|
| InChIKey |
XRCFXMGQEVUZFC-UHFFFAOYSA-N
|
| CAS Number |
CAS 117-37-3
|
| PubChem Compound ID |
|
| PubChem Substance ID |
3150799, 5141622, 7907525, 8149855, 8151491, 10505123, 11335511, 11360750, 11364249, 11366811, 11369373, 11372509, 11374125, 11377535, 11461722, 11484150, 11488243, 11491340, 11492538, 11495169, 14729672, 15391997, 26537315, 26612327, 26679795, 26748631, 26748632, 29221375, 46504660, 47291049, 47515233, 48035021, 48184919, 48415571, 49982247, 50086377, 50107437, 50609859, 51091788, 57288748, 57321195, 58000062, 85333593, 92124482, 92307614, 99301424, 103194851, 104121859, 104299892, 105534934
|
| Target and Pathway |
| Target(s) |
Coagulation factor IIa |
Target Info |
Modulator |
[3]
|
|---|
|
KEGG Pathway
|
Neuroactive ligand-receptor interaction
|
|
Complement and coagulation cascades
|
|
Regulation of actin cytoskeleton
|
|
NetPath Pathway
|
TCR Signaling Pathway
|
|
PANTHER Pathway
|
Blood coagulation
|
|
Pathway Interaction Database
|
Thrombin/protease-activated receptor (PAR) pathway
|
|
Angiopoietin receptor Tie2-mediated signaling
|
|
FOXA2 and FOXA3 transcription factor networks
|
|
PAR4-mediated thrombin signaling events
|
|
Syndecan-4-mediated signaling events
|
|
PAR1-mediated thrombin signaling events
|
|
PathWhiz Pathway
|
Vitamin K Metabolism
|
|
Coagulation
|
|
Reactome
|
Intrinsic Pathway of Fibrin Clot Formation
|
|
Common Pathway of Fibrin Clot Formation
|
|
Gamma-carboxylation of protein precursors
|
|
Transport of gamma-carboxylated protein precursors from the endoplasmic reticulum to the Golgi apparatus
|
|
Removal of aminoterminal propeptides from gamma-carboxylated proteins
|
|
Cell surface interactions at the vascular wall
|
|
Peptide ligand-binding receptors
|
|
Regulation of Insulin-like Growth Factor (IGF) transport and uptake by Insulin-like Growth Factor Binding Proteins (IGFBPs)
|
|
G alpha (q) signalling events
|
|
Thrombin signalling through proteinase activated receptors (PARs)
|
|
WikiPathways
|
Complement and Coagulation Cascades
|
|
Regulation of Actin Cytoskeleton
|
|
IL1 and megakaryotyces in obesity
|
|
Regulation of Insulin-like Growth Factor (IGF) Transport and Uptake by Insulin-like Growth Factor Binding Proteins (IGFBPs)
|
|
PTM: gamma carboxylation, hypusine formation and arylsulfatase activation
|
|
Blood Clotting Cascade
|
|
Gastrin-CREB signalling pathway via PKC and MAPK
|
|
Thrombin signalling through proteinase activated receptors (PARs)
|
|
Platelet Aggregation (Plug Formation)
|
|
GPCR ligand binding
|
|
GPCR downstream signaling
|
|
Formation of Fibrin Clot (Clotting Cascade)
|
|
Cell surface interactions at the vascular wall
|
|
Folate Metabolism
|
|
Vitamin B12 Metabolism
|
|
Selenium Micronutrient Network
|
| References |
| REF 1 | FDA Approved Drug Products from FDA Official Website. 2009. Application Number: (NDA) 010909. |
|---|
| REF 2 | (http://www.guidetopharmacology.org/) Nucleic Acids Res. 2015 Oct 12. pii: gkv1037. The IUPHAR/BPS Guide to PHARMACOLOGY in 2016: towards curated quantitative interactions between 1300 protein targets and 6000 ligands. (Ligand id: 6960). |
|---|
| REF 3 | Anticoagulation with anisindione in a patient with a warfarin-induced skin eruption. Pharmacotherapy. 2003 Apr;23(4):533-6. |
|---|
