| Drug General Information |
| Drug ID |
D09GRO
|
| Former ID |
DNC003974
|
| Drug Name |
DITOLYLGUANIDINE
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
|
| Formula |
C15H17N3
|
| Canonical SMILES |
CC1=CC=CC=C1NC(=NC2=CC=CC=C2C)N
|
| InChI |
1S/C15H17N3/c1-11-7-3-5-9-13(11)17-15(16)18-14-10-6-4-8-12(14)2/h3-10H,1-2H3,(H3,16,17,18)
|
| InChIKey |
OPNUROKCUBTKLF-UHFFFAOYSA-N
|
| CAS Number |
CAS 97-39-2
|
| PubChem Compound ID |
|
| Target and Pathway |
| Target(s) |
Sigma(1)-type opioid receptor |
Target Info |
Inhibitor |
[2]
|
|---|
| NMDA receptor subunit NR1 |
Target Info |
Inhibitor |
[1]
|
| Glutamate [NMDA] receptor subunit epsilon 2 |
Target Info |
Inhibitor |
[1]
|
| Glutamate [NMDA] receptor subunit epsilon 1 |
Target Info |
Inhibitor |
[1]
|
|
KEGG Pathway
|
Ras signaling pathway
|
|
Rap1 signaling pathway
|
|
Calcium signaling pathway
|
|
cAMP signaling pathway
|
|
Neuroactive ligand-receptor interaction
|
|
Circadian entrainment
|
|
Long-term potentiation
|
|
Glutamatergic synapse
|
|
Alzheimer's disease
|
|
Amyotrophic lateral sclerosis (ALS)
|
|
Huntington's disease
|
|
Cocaine addiction
|
|
Amphetamine addiction
|
|
Nicotine addiction
|
|
Alcoholismhsa04014:Ras signaling pathway
|
|
Dopaminergic synapse
|
|
Alcoholism
|
|
Systemic lupus erythematosushsa04014:Ras signaling pathway
|
|
Systemic lupus erythematosus
|
|
PANTHER Pathway
|
Huntington disease
|
|
Ionotropic glutamate receptor pathway
|
|
Metabotropic glutamate receptor group III pathway
|
|
Metabotropic glutamate receptor group I pathway
|
|
Muscarinic acetylcholine receptor 1 and 3 signaling pathwayP00029:Huntington disease
|
|
Muscarinic acetylcholine receptor 1 and 3 signaling pathway
|
|
Pathway Interaction Database
|
ErbB4 signaling events
|
|
Reelin signaling pathwayreelinpathway:Reelin signaling pathway
|
|
Reactome
|
EPHB-mediated forward signaling
|
|
Unblocking of NMDA receptor, glutamate binding and activation
|
|
CREB phosphorylation through the activation of CaMKII
|
|
Ras activation uopn Ca2+ infux through NMDA receptor
|
|
RAF/MAP kinase cascadeR-HSA-3928662:EPHB-mediated forward signaling
|
|
RAF/MAP kinase cascadeR-HSA-438066:Unblocking of NMDA receptor, glutamate binding and activation
|
|
RAF/MAP kinase cascade
|
|
WikiPathways
|
miR-targeted genes in squamous cell - TarBase
|
|
miR-targeted genes in lymphocytes - TarBaseWP706:SIDS Susceptibility Pathways
|
|
Hypothetical Network for Drug Addiction
|
|
Neurotransmitter Receptor Binding And Downstream Transmission In The Postsynaptic Cell
|
|
Spinal Cord Injury
|
|
BDNF signaling pathway
|
|
Alzheimers DiseaseWP666:Hypothetical Network for Drug Addiction
|
|
BDNF signaling pathwayWP666:Hypothetical Network for Drug Addiction
|
|
Alzheimers Disease
|
| References |
| REF 1 | J Med Chem. 1998 Aug 13;41(17):3298-302.Synthesis and pharmacological evaluation of N,N'-diarylguanidines as potent sodium channel blockers and anticonvulsant agents. |
|---|
| REF 2 | J Med Chem. 1994 Jun 10;37(12):1737-9.Synthesis and characterization of [125I]-N-(N-benzylpiperidin-4-yl)-4- iodobenzamide, a new sigma receptor radiopharmaceutical: high-affinity binding to MCF-7 breast tumor cells. |
|---|
