| Drug General Information |
| Drug ID |
D08OLP
|
| Former ID |
DNC003815
|
| Drug Name |
2-(2-Hydroxy-phenyl)-1H-indole-5-carboxamidine
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C15H14N3O+
|
| Canonical SMILES |
C1=CC=C(C(=C1)C2=CC3=C(N2)C=CC(=C3)C(=N)N)O
|
| InChI |
1S/C15H13N3O/c16-15(17)9-5-6-12-10(7-9)8-13(18-12)11-3-1-2-4-14(11)19/h1-8,18-19H,(H3,16,17)
|
| InChIKey |
JPGNPKIYCTXJPG-UHFFFAOYSA-N
|
| PubChem Compound ID |
|
| Target and Pathway |
| Target(s) |
Trypsin |
Target Info |
Inhibitor |
[1]
|
|---|
| Coagulation factor IIa |
Target Info |
Inhibitor |
[1]
|
| Plasminogen |
Target Info |
Inhibitor |
[1]
|
| Urokinase-type plasminogen activator |
Target Info |
Inhibitor |
[1]
|
| Tissue-type plasminogen activator |
Target Info |
Inhibitor |
[1]
|
|
KEGG Pathway
|
Neuroactive ligand-receptor interaction
|
|
Pancreatic secretion
|
|
Protein digestion and absorption
|
|
Influenza Ahsa04080:Neuroactive ligand-receptor interaction
|
|
Complement and coagulation cascades
|
|
Regulation of actin cytoskeletonhsa04080:Neuroactive ligand-receptor interaction
|
|
Staphylococcus aureus infection
|
|
Influenza Ahsa04064:NF-kappa B signaling pathway
|
|
Transcriptional misregulation in cancer
|
|
Proteoglycans in cancer
|
|
MicroRNAs in cancerhsa04610:Complement and coagulation cascades
|
|
NetPath Pathway
|
TCR Signaling PathwayNetPath_14:IL2 Signaling Pathway
|
|
EGFR1 Signaling PathwayNetPath_17:IL5 Signaling Pathway
|
|
PANTHER Pathway
|
Blood coagulationP00011:Blood coagulation
|
|
Plasminogen activating cascadeP00011:Blood coagulation
|
|
Plasminogen activating cascade
|
|
CCKR signaling map STP00011:Blood coagulation
|
|
Pathway Interaction Database
|
Thrombin/protease-activated receptor (PAR) pathway
|
|
Angiopoietin receptor Tie2-mediated signaling
|
|
FOXA2 and FOXA3 transcription factor networks
|
|
PAR4-mediated thrombin signaling events
|
|
Syndecan-4-mediated signaling events
|
|
PAR1-mediated thrombin signaling eventsangiopoietinreceptor_pathway:Angiopoietin receptor Tie2-mediated signaling
|
|
p75(NTR)-mediated signaling
|
|
amb2 Integrin signaling
|
|
Urokinase-type plasminogen activator (uPA) and uPAR-mediated signalingintegrin1_pathway:Beta1 integrin cell surface interactions
|
|
E2F transcription factor network
|
|
Beta3 integrin cell surface interactions
|
|
Osteopontin-mediated events
|
|
Validated transcriptional targets of AP1 family members Fra1 and Fra2
|
|
ATF-2 transcription factor network
|
|
AP-1 transcription factor network
|
|
Beta2 integrin cell surface interactions
|
|
Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling
|
|
Beta5 beta6 beta7 and beta8 integrin cell surface interactions
|
|
FGF signaling pathwayamb2_neutrophils_pathway:amb2 Integrin signaling
|
|
PathWhiz Pathway
|
Vitamin K Metabolism
|
|
CoagulationPW000562:CoagulationPW000562:Coagulation
|
|
Reactome
|
Activation of Matrix Metalloproteinases
|
|
Cobalamin (Cbl, vitamin B12) transport and metabolismR-HSA-140837:Intrinsic Pathway of Fibrin Clot Formation
|
|
Common Pathway of Fibrin Clot Formation
|
|
Gamma-carboxylation of protein precursors
|
|
Transport of gamma-carboxylated protein precursors from the endoplasmic reticulum to the Golgi apparatus
|
|
Removal of aminoterminal propeptides from gamma-carboxylated proteins
|
|
Cell surface interactions at the vascular wall
|
|
Peptide ligand-binding receptors
|
|
Regulation of Insulin-like Growth Factor (IGF) transport and uptake by Insulin-like Growth Factor Binding Proteins (IGFBPs)
|
|
G alpha (q) signalling events
|
|
Thrombin signalling through proteinase activated receptors (PARs)R-HSA-114608:Platelet degranulation
|
|
Degradation of the extracellular matrix
|
|
Dissolution of Fibrin ClotR-HSA-75205:Dissolution of Fibrin ClotR-HSA-75205:Dissolution of Fibrin Clot
|
|
WikiPathways
|
Activation of Matrix MetalloproteinasesWP558:Complement and Coagulation Cascades
|
|
Regulation of Actin Cytoskeleton
|
|
IL1 and megakaryotyces in obesity
|
|
Regulation of Insulin-like Growth Factor (IGF) Transport and Uptake by Insulin-like Growth Factor Binding Proteins (IGFBPs)
|
|
PTM: gamma carboxylation, hypusine formation and arylsulfatase activation
|
|
Blood Clotting Cascade
|
|
Gastrin-CREB signalling pathway via PKC and MAPK
|
|
Thrombin signalling through proteinase activated receptors (PARs)
|
|
Platelet Aggregation (Plug Formation)
|
|
GPCR ligand binding
|
|
GPCR downstream signaling
|
|
Formation of Fibrin Clot (Clotting Cascade)
|
|
Cell surface interactions at the vascular wall
|
|
Folate Metabolism
|
|
Vitamin B12 Metabolism
|
|
Selenium Micronutrient NetworkWP558:Complement and Coagulation Cascades
|
|
Human Complement System
|
|
Activation of Matrix Metalloproteinases
|
|
Dissolution of Fibrin Clot
|
|
Selenium Micronutrient NetworkWP710:DNA Damage Response (only ATM dependent)
|
|
Senescence and Autophagy in Cancer
|
|
Complement and Coagulation Cascades
|
|
Endochondral Ossification
|
|
Wnt Signaling Pathway
|
|
Wnt Signaling Pathway and Pluripotency
|
|
Osteopontin SignalingWP615:Senescence and Autophagy in Cancer
|
|
Selenium Micronutrient Network
|
| References |
| REF 1 | J Med Chem. 2001 Aug 16;44(17):2753-71.Development of serine protease inhibitors displaying a multicentered short (<2.3 A) hydrogen bond binding mode: inhibitors of urokinase-type plasminogen activator and factor Xa. |
|---|
