| Drug General Information |
| Drug ID |
D06PIA
|
| Former ID |
DNC000756
|
| Drug Name |
Hymenialdisine
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C11H10BrN5O2
|
| Canonical SMILES |
C1CNC(=O)C2=C(C1=C3C(=O)N=C(N3)N)C=C(N2)Br
|
| InChI |
1S/C11H10BrN5O2/c12-6-3-5-4(7-10(19)17-11(13)16-7)1-2-14-9(18)8(5)15-6/h3,15H,1-2H2,(H,14,18)(H3,13,16,17,19)/b7-4-
|
| InChIKey |
ATBAETXFFCOZOY-DAXSKMNVSA-N
|
| PubChem Compound ID |
|
| PubChem Substance ID |
484744, 492824, 10048382, 10319107, 10319108, 11108282, 11114598, 12015383, 14850668, 36078929, 51011451, 57353110, 103450226, 104003944, 111639024, 134339577, 135078876, 142365860, 179231023, 202535658, 226520067, 240371749, 241163263, 241182507, 241375484
|
| Target and Pathway |
| Target(s) |
Cell division protein kinase 2 |
Target Info |
Inhibitor |
[1]
|
|---|
| Cell division protein kinase 5 |
Target Info |
Inhibitor |
[1]
|
|
KEGG Pathway
|
FoxO signaling pathway
|
|
Cell cycle
|
|
Oocyte meiosis
|
|
p53 signaling pathway
|
|
PI3K-Akt signaling pathway
|
|
Progesterone-mediated oocyte maturation
|
|
Hepatitis B
|
|
Measles
|
|
Herpes simplex infection
|
|
Epstein-Barr virus infection
|
|
Pathways in cancer
|
|
Viral carcinogenesis
|
|
Prostate cancer
|
|
Small cell lung cancerhsa04360:Axon guidance
|
|
Alzheimer's disease
|
|
Cocaine addiction
|
|
NetPath Pathway
|
TCR Signaling PathwayNetPath_4:EGFR1 Signaling Pathway
|
|
TCR Signaling Pathway
|
|
PANTHER Pathway
|
p53 pathway
|
|
p53 pathway feedback loops 2P00007:Axon guidance mediated by semaphorins
|
|
Pathway Interaction Database
|
Regulation of nuclear SMAD2/3 signaling
|
|
Signaling events mediated by PRL
|
|
p73 transcription factor network
|
|
E2F transcription factor network
|
|
ATR signaling pathway
|
|
mTOR signaling pathway
|
|
IL2-mediated signaling events
|
|
FoxO family signaling
|
|
FOXM1 transcription factor network
|
|
BARD1 signaling events
|
|
p53 pathway
|
|
Regulation of retinoblastoma proteinreelinpathway:Reelin signaling pathway
|
|
Glucocorticoid receptor regulatory network
|
|
Lissencephaly gene (LIS1) in neuronal migration and development
|
|
EPHA forward signaling
|
|
Trk receptor signaling mediated by the MAPK pathway
|
|
Reactome
|
G0 and Early G1
|
|
Activation of ATR in response to replication stress
|
|
Regulation of APC/C activators between G1/S and early anaphase
|
|
SCF(Skp2)-mediated degradation of p27/p21
|
|
Senescence-Associated Secretory Phenotype (SASP)
|
|
DNA Damage/Telomere Stress Induced Senescence
|
|
Processing of DNA double-strand break ends
|
|
G2 Phase
|
|
Orc1 removal from chromatin
|
|
Cyclin E associated events during G1/S transition
|
|
Cyclin A/B1 associated events during G2/M transition
|
|
p53-Dependent G1 DNA Damage Response
|
|
Cyclin A:Cdk2-associated events at S phase entry
|
|
Meiotic recombination
|
|
Factors involved in megakaryocyte development and platelet productionR-HSA-180024:DARPP-32 events
|
|
CRMPs in Sema3A signaling
|
|
Factors involved in megakaryocyte development and platelet production
|
|
WikiPathways
|
DNA Damage Response
|
|
ID signaling pathway
|
|
DNA Replication
|
|
G1 to S cell cycle control
|
|
M/G1 Transition
|
|
S Phase
|
|
Meiotic Recombination
|
|
Aryl Hydrocarbon Receptor
|
|
ATM Signaling Pathway
|
|
Retinoblastoma (RB) in Cancer
|
|
Spinal Cord Injury
|
|
Integrated Pancreatic Cancer Pathway
|
|
Oncostatin M Signaling Pathway
|
|
Prostate Cancer
|
|
Signaling Pathways in Glioblastoma
|
|
TSH signaling pathway
|
|
Integrated Breast Cancer Pathway
|
|
Integrated Cancer pathway
|
|
Synthesis of DNA
|
|
Regulation of DNA replication
|
|
Mitotic G2-G2/M phases
|
|
Mitotic G1-G1/S phases
|
|
Factors involved in megakaryocyte development and platelet production
|
|
Cell Cycle
|
|
APC/C-mediated degradation of cell cycle proteins
|
|
Cell Cycle Checkpoints
|
|
miRNA Regulation of DNA Damage ResponseWP707:DNA Damage Response
|
|
BDNF signaling pathway
|
|
Alzheimers Disease
|
|
Opioid Signalling
|
|
Semaphorin interactions
|
|
Nicotine Activity on Dopaminergic Neurons
|
|
miRNA Regulation of DNA Damage Response
|
| References |
| REF 1 | Pharmacological inhibitors of cyclin-dependent kinases. Trends Pharmacol Sci. 2002 Sep;23(9):417-25. |
|---|
