| Drug General Information |
| Drug ID |
D06ALB
|
| Former ID |
DNC000288
|
| Drug Name |
BCH-2763
|
| Drug Type |
Small molecular drug
|
| Indication |
Thrombosis [ICD9: 437.6, 453, 671.5, 671.9; ICD10:I80-I82]
|
Terminated |
[1]
|
|---|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C20H38N6O4
|
| Canonical SMILES |
CC(C)CC(C(=O)NC(CC(C)C)C(=O)NC(CCCN=C(N)N)C=O)NC(=O)C
|
| InChI |
1S/C20H38N6O4/c1-12(2)9-16(24-14(5)28)19(30)26-17(10-13(3)4)18(29)25-15(11-27)7-6-8-23-20(21)22/h11-13,15-17H,6-10H2,1-5H3,(H,24,28)(H,25,29)(H,26,30)(H4,21,22,23)/t15-,16-,17-/m0/s1
|
| InChIKey |
GDBQQVLCIARPGH-ULQDDVLXSA-N
|
| CAS Number |
CAS 24365-47-7
|
| PubChem Compound ID |
|
| PubChem Substance ID |
602112, 7979525, 11121773, 11122253, 11362949, 11365511, 11368073, 11371069, 11371070, 11373674, 11376235, 16003641, 26756847, 43128595, 47944494, 48170149, 48413940, 49857450, 50061803, 50078012, 50111452, 53788333, 56231459, 57318714, 77099929, 92310124, 99301036, 99302556, 104060153, 104352924, 117585558, 127936552, 134339750, 134339752, 134339755, 134339756, 134340176, 135030613, 139421944, 160661376, 175267735, 184589588, 223653355, 226888611, 241182192, 241375264, 242084562, 249617260, 250132850, 252344670
|
| Target and Pathway |
| Target(s) |
Coagulation factor IIa |
Target Info |
Inhibitor |
[2]
|
|---|
|
KEGG Pathway
|
Neuroactive ligand-receptor interaction
|
|
Complement and coagulation cascades
|
|
Regulation of actin cytoskeleton
|
|
NetPath Pathway
|
TCR Signaling Pathway
|
|
PANTHER Pathway
|
Blood coagulation
|
|
Pathway Interaction Database
|
Thrombin/protease-activated receptor (PAR) pathway
|
|
Angiopoietin receptor Tie2-mediated signaling
|
|
FOXA2 and FOXA3 transcription factor networks
|
|
PAR4-mediated thrombin signaling events
|
|
Syndecan-4-mediated signaling events
|
|
PAR1-mediated thrombin signaling events
|
|
PathWhiz Pathway
|
Vitamin K Metabolism
|
|
Coagulation
|
|
Reactome
|
Intrinsic Pathway of Fibrin Clot Formation
|
|
Common Pathway of Fibrin Clot Formation
|
|
Gamma-carboxylation of protein precursors
|
|
Transport of gamma-carboxylated protein precursors from the endoplasmic reticulum to the Golgi apparatus
|
|
Removal of aminoterminal propeptides from gamma-carboxylated proteins
|
|
Cell surface interactions at the vascular wall
|
|
Peptide ligand-binding receptors
|
|
Regulation of Insulin-like Growth Factor (IGF) transport and uptake by Insulin-like Growth Factor Binding Proteins (IGFBPs)
|
|
G alpha (q) signalling events
|
|
Thrombin signalling through proteinase activated receptors (PARs)
|
|
WikiPathways
|
Complement and Coagulation Cascades
|
|
Regulation of Actin Cytoskeleton
|
|
IL1 and megakaryotyces in obesity
|
|
Regulation of Insulin-like Growth Factor (IGF) Transport and Uptake by Insulin-like Growth Factor Binding Proteins (IGFBPs)
|
|
PTM: gamma carboxylation, hypusine formation and arylsulfatase activation
|
|
Blood Clotting Cascade
|
|
Gastrin-CREB signalling pathway via PKC and MAPK
|
|
Thrombin signalling through proteinase activated receptors (PARs)
|
|
Platelet Aggregation (Plug Formation)
|
|
GPCR ligand binding
|
|
GPCR downstream signaling
|
|
Formation of Fibrin Clot (Clotting Cascade)
|
|
Cell surface interactions at the vascular wall
|
|
Folate Metabolism
|
|
Vitamin B12 Metabolism
|
|
Selenium Micronutrient Network
|
| References |
| REF 1 | Trusted, scientifically sound profiles of drug programs, clinical trials, safety reports, and company deals, written by scientists. Springer. 2015. Adis Insight (drug id 800007017) |
|---|
| REF 2 | BCH-2763, a novel potent parenteral thrombin inhibitor, is an effective antithrombotic agent in rodent models of arterial and venous thrombosis--comparisons with heparin, r-hirudin, hirulog, inogatran and argatroban. Thromb Haemost. 1998 Feb;79(2):431-8. |
|---|
