| Drug General Information |
| Drug ID |
D04AQE
|
| Former ID |
DNC004868
|
| Drug Name |
5-METHOXYTRYPTAMINE
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C11H14N2O
|
| InChI |
InChI=1S/C11H14N2O/c1-14-9-2-3-11-10(6-9)8(4-5-12)7-13-11/h2-3,6-7,13H,4-5,12H2,1H3
|
| InChIKey |
JTEJPPKMYBDEMY-UHFFFAOYSA-N
|
| PubChem Compound ID |
|
| PubChem Substance ID |
7970, 105814, 803909, 3133821, 5496811, 7636332, 7736866, 8151307, 10529440, 11111484, 11152249, 11363087, 11365649, 11368211, 11374263, 11376373, 11484978, 11488927, 11492417, 11494007, 14719328, 15171512, 24286968, 24857245, 24883984, 26755698, 26755699, 29221032, 41877487, 46387021, 46530516, 47440450, 47810946, 48035326, 48035327, 48185165, 49748019, 49748020, 49829958, 49983314, 50111152, 53795942, 57321043, 57565614, 58023683, 77137071, 81040761, 81049398, 81065577, 85087623
|
| Target and Pathway |
| Target(s) |
5-hydroxytryptamine 6 receptor |
Target Info |
Inhibitor |
[2]
|
|---|
| 5-hydroxytryptamine 2A receptor |
Target Info |
Inhibitor |
[3]
|
| TRPM8 protein |
Target Info |
Inhibitor |
[4]
|
|
KEGG Pathway
|
Calcium signaling pathway
|
|
cAMP signaling pathway
|
|
Neuroactive ligand-receptor interaction
|
|
Serotonergic synapsehsa04020:Calcium signaling pathway
|
|
Gap junction
|
|
Serotonergic synapse
|
|
Inflammatory mediator regulation of TRP channelshsa04750:Inflammatory mediator regulation of TRP channels
|
|
PANTHER Pathway
|
Heterotrimeric G-protein signaling pathway-Gi alpha and Gs alpha mediated pathwayP04374:5HT2 type receptor mediated signaling pathway
|
|
PathWhiz Pathway
|
Excitatory Neural Signalling Through 5-HTR 6 and Serotonin
|
|
Reactome
|
Serotonin receptors
|
|
G alpha (s) signalling eventsR-HSA-390666:Serotonin receptors
|
|
G alpha (q) signalling eventsR-HSA-3295583:TRP channels
|
|
WikiPathways
|
Serotonin Receptor 4/6/7 and NR3C Signaling
|
|
Monoamine GPCRs
|
|
GPCRs, Class A Rhodopsin-like
|
|
GPCR ligand binding
|
|
GPCR downstream signalingWP733:Serotonin Receptor 2 and STAT3 Signaling
|
|
Serotonin Receptor 2 and ELK-SRF/GATA4 signaling
|
|
SIDS Susceptibility Pathways
|
|
Gastrin-CREB signalling pathway via PKC and MAPK
|
|
GPCR downstream signaling
|
|
GPCRs, Other
|
| References |
| REF 1 | (http://www.guidetopharmacology.org/) Nucleic Acids Res. 2015 Oct 12. pii: gkv1037. The IUPHAR/BPS Guide to PHARMACOLOGY in 2016: towards curated quantitative interactions between 1300 protein targets and 6000 ligands. (Ligand id: 107). |
|---|
| REF 2 | J Med Chem. 2005 Mar 24;48(6):1781-95.Medicinal chemistry driven approaches toward novel and selective serotonin 5-HT6 receptor ligands. |
|---|
| REF 3 | J Med Chem. 1987 Jan;30(1):1-12.Central serotonin receptors as targets for drug research. |
|---|
| REF 4 | Bioorg Med Chem Lett. 2010 Dec 1;20(23):7076-9. Epub 2010 Sep 22.5-benzyloxytryptamine as an antagonist of TRPM8. |
|---|
