| Drug General Information |
| Drug ID |
D03QJL
|
| Former ID |
DCL000838
|
| Drug Name |
Ibudilast
|
| Synonyms |
Eyevinal; Ibudilastum; Ketas; Ibudilastum [Latin]; Ke Tas; AV 411; I 0157; KC 404; AV-411; Ibudilast [INN:JAN]; KC-404; Ketas (TN); MN-166; Ibudilast (JAN/INN); 1-(2-Isopropylpyrazolo(1,5-a)pyridin-3-yl)-2-methyl-1-propanone; 2-Isopropyl-3-isobutyrylpyrazolo(1,5-a)pyridine; 2-Methyl-1-[2-(1-methylethyl)pyrazolo[1,5-a]pyridin-3-yl] 1-propanone; 2-methyl-1-(2-propan-2-ylpyrazolo[1,5-a]pyridin-3-yl)propan-1-one; 3-Isobutyryl-2-isopropylpyrazolo(1,5-a)pyridine; 3-Isobutyryl-2-isopropylpyrazolo[1,5-a]pyridine
|
| Drug Type |
Small molecular drug
|
| Indication |
Opioid-related disorders; Diabetic neuropathy [ICD9: 250, 250.6, 292, 304.0, 305.50, 356.0, 356.8; ICD10:E08-E13, E10.4, E11.4, E13.4, F11, G64, G90.0]
|
Phase 2 |
[1],
[2]
|
|---|
| Company |
Avigen
|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C14H18N2O
|
| InChI |
InChI=1S/C14H18N2O/c1-9(2)13-12(14(17)10(3)4)11-7-5-6-8-16(11)15-13/h5-10H,1-4H3
|
| InChIKey |
ZJVFLBOZORBYFE-UHFFFAOYSA-N
|
| CAS Number |
CAS 50847-11-5
|
| PubChem Compound ID |
|
| PubChem Substance ID |
6240817, 7848448, 8152317, 11111307, 11114182, 12013668, 14822917, 17405161, 24278482, 29222794, 46500478, 47440428, 50030118, 50104937, 50104938, 53777705, 53788639, 57321931, 58107098, 79769657, 81041136, 81092873, 85211314, 85231085, 85787627, 87561227, 90341511, 91613941, 92303863, 92308717, 92711901, 99443231, 103185681, 104098264, 104304184, 121361284, 124397894, 124749844, 124800500, 124880396, 124880397, 124880398, 124887049, 125351724, 126630415, 126657050, 126670483, 129913079, 131316644, 134339304
|
| SuperDrug ATC ID |
R03DC04
|
| SuperDrug CAS ID |
cas=050847115
|
| Target and Pathway |
| Target(s) |
Interleukin-1 beta |
Target Info |
Inhibitor |
[1]
|
|---|
| Interleukin-6 |
Target Info |
Inhibitor |
[1]
|
|
KEGG Pathway
|
MAPK signaling pathway
|
|
Cytokine-cytokine receptor interaction
|
|
NF-kappa B signaling pathway
|
|
Apoptosis
|
|
Osteoclast differentiation
|
|
Toll-like receptor signaling pathway
|
|
NOD-like receptor signaling pathway
|
|
Cytosolic DNA-sensing pathway
|
|
Hematopoietic cell lineage
|
|
TNF signaling pathway
|
|
Inflammatory mediator regulation of TRP channels
|
|
Non-alcoholic fatty liver disease (NAFLD)
|
|
Type I diabetes mellitus
|
|
Alzheimer's disease
|
|
Prion diseases
|
|
Salmonella infection
|
|
Pertussis
|
|
Legionellosis
|
|
Leishmaniasis
|
|
Chagas disease (American trypanosomiasis)
|
|
African trypanosomiasis
|
|
Malaria
|
|
Amoebiasis
|
|
Tuberculosis
|
|
Measles
|
|
Influenza A
|
|
Herpes simplex infection
|
|
Inflammatory bowel disease (IBD)
|
|
Rheumatoid arthritis
|
|
Graft-versus-host diseasehsa04060:Cytokine-cytokine receptor interaction
|
|
HIF-1 signaling pathway
|
|
FoxO signaling pathway
|
|
PI3K-Akt signaling pathway
|
|
Jak-STAT signaling pathway
|
|
Intestinal immune network for IgA production
|
|
Hepatitis B
|
|
HTLV-I infection
|
|
Pathways in cancer
|
|
Transcriptional misregulation in cancer
|
|
Graft-versus-host disease
|
|
Hypertrophic cardiomyopathy (HCM)
|
|
NetPath Pathway
|
Leptin Signaling Pathway
|
|
IL5 Signaling Pathway
|
|
IL1 Signaling Pathway
|
|
IL2 Signaling Pathway
|
|
IL3 Signaling Pathway
|
|
TGF_beta_Receptor Signaling Pathway
|
|
Wnt Signaling Pathway
|
|
TCR Signaling Pathway
|
|
TNFalpha Signaling PathwayNetPath_13:IL1 Signaling Pathway
|
|
TWEAK Signaling Pathway
|
|
IL4 Signaling Pathway
|
|
TNFalpha Signaling Pathway
|
|
Alpha6Beta4Integrin Signaling Pathway
|
|
TSLP Signaling Pathway
|
|
RANKL Signaling Pathway
|
|
PANTHER Pathway
|
Interleukin signaling pathway
|
|
Pathway Interaction Database
|
IL27-mediated signaling events
|
|
IL12-mediated signaling events
|
|
IL1-mediated signaling events
|
|
IFN-gamma pathway
|
|
IL23-mediated signaling events
|
|
Cellular roles of Anthrax toxinlysophospholipid_pathway:LPA receptor mediated events
|
|
Validated transcriptional targets of AP1 family members Fra1 and Fra2
|
|
SHP2 signaling
|
|
Glucocorticoid receptor regulatory network
|
|
amb2 Integrin signaling
|
|
ATF-2 transcription factor network
|
|
AP-1 transcription factor network
|
|
IL6-mediated signaling events
|
|
Reactome
|
Interleukin-1 signaling
|
|
Interleukin-1 processing
|
|
CLEC7A/inflammasome pathwayR-HSA-1059683:Interleukin-6 signaling
|
|
MAPK3 (ERK1) activation
|
|
MAPK1 (ERK2) activation
|
|
Senescence-Associated Secretory Phenotype (SASP)
|
|
WikiPathways
|
Toll-like receptor signaling pathway
|
|
Monoamine Transport
|
|
SIDS Susceptibility Pathways
|
|
TCR Signaling Pathway
|
|
Type II interferon signaling (IFNG)
|
|
Senescence and Autophagy in Cancer
|
|
Cytokines and Inflammatory Response
|
|
MAPK Signaling Pathway
|
|
Myometrial Relaxation and Contraction Pathways
|
|
Aryl Hydrocarbon Receptor Pathway
|
|
IL1 and megakaryotyces in obesity
|
|
Hematopoietic Stem Cell Differentiation
|
|
Spinal Cord Injury
|
|
Allograft Rejection
|
|
Alzheimers Disease
|
|
Leptin signaling pathway
|
|
IL-1 signaling pathway
|
|
Interleukin-1 signaling
|
|
Folate Metabolism
|
|
Vitamin B12 Metabolism
|
|
Selenium Micronutrient Network
|
|
Serotonin Transporter Activity
|
|
Regulation of toll-like receptor signaling pathway
|
|
NOD pathwayWP75:Toll-like receptor signaling pathway
|
|
IL-6 signaling pathway
|
|
Differentiation Pathway
|
|
Interleukin-6 signaling
|
|
Adipogenesis
|
|
TNF alpha Signaling Pathway
|
|
TSLP Signaling Pathway
|
|
TWEAK Signaling Pathway
|
| References |
| REF 1 | Emerging drugs in neuropathic pain. Expert Opin Emerg Drugs. 2007 Mar;12(1):113-26. |
|---|
| REF 2 | (http://www.guidetopharmacology.org/) Nucleic Acids Res. 2015 Oct 12. pii: gkv1037. The IUPHAR/BPS Guide to PHARMACOLOGY in 2016: towards curated quantitative interactions between 1300 protein targets and 6000 ligands. (Ligand id: 7399). |
|---|
