| Drug General Information |
| Drug ID |
D02TTF
|
| Former ID |
DNC012166
|
| Drug Name |
YM-90K
|
| Drug Type |
Small molecular drug
|
| Indication |
Convulsions [ICD9: 780.3; ICD10:R56.0]
|
Discontinued in Phase 2 |
[1]
|
|---|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C11H8ClN5O4
|
| Canonical SMILES |
C1=CN(C=N1)C2=C(C=C3C(=C2)NC(=O)C(=O)N3)[N+](=O)[O-].Cl
|
| InChI |
1S/C11H7N5O4.ClH/c17-10-11(18)14-7-4-9(16(19)20)8(3-6(7)13-10)15-2-1-12-5-15;/h1-5H,(H,13,17)(H,14,18);1H
|
| InChIKey |
UMLFDVOHVJPDIZ-UHFFFAOYSA-N
|
| PubChem Compound ID |
|
| Target and Pathway |
| Target(s) |
Glutamate receptor, ionotropic kainate 1 |
Target Info |
Inhibitor |
[2]
|
|---|
| Glutamate receptor 1 |
Target Info |
Inhibitor |
[3]
|
| NMDA receptor subunit NR1 |
Target Info |
Inhibitor |
[2]
|
| Glutamate [NMDA] receptor subunit epsilon 1 |
Target Info |
Inhibitor |
[2]
|
| Glutamate receptor AMPA subtype |
Target Info |
Inhibitor |
[3]
|
| Glutamate [NMDA] receptor subunit epsilon 2 |
Target Info |
Inhibitor |
[2]
|
|
KEGG Pathway
|
Neuroactive ligand-receptor interaction
|
|
Glutamatergic synapsehsa04024:cAMP signaling pathway
|
|
Circadian entrainment
|
|
Long-term potentiation
|
|
Retrograde endocannabinoid signaling
|
|
Glutamatergic synapse
|
|
Dopaminergic synapse
|
|
Long-term depression
|
|
Amyotrophic lateral sclerosis (ALS)
|
|
Amphetamine addiction
|
|
Nicotine addictionhsa04014:Ras signaling pathway
|
|
Rap1 signaling pathway
|
|
Calcium signaling pathway
|
|
cAMP signaling pathway
|
|
Alzheimer's disease
|
|
Huntington's disease
|
|
Cocaine addiction
|
|
Nicotine addiction
|
|
Alcoholismhsa04014:Ras signaling pathway
|
|
Alcoholism
|
|
Systemic lupus erythematosushsa04014:Ras signaling pathway
|
|
Systemic lupus erythematosus
|
|
PANTHER Pathway
|
Huntington disease
|
|
Ionotropic glutamate receptor pathway
|
|
Metabotropic glutamate receptor group III pathway
|
|
Metabotropic glutamate receptor group I pathwayP00037:Ionotropic glutamate receptor pathway
|
|
Metabotropic glutamate receptor group III pathwayP00029:Huntington disease
|
|
Metabotropic glutamate receptor group I pathway
|
|
Muscarinic acetylcholine receptor 1 and 3 signaling pathwayP00029:Huntington disease
|
|
Muscarinic acetylcholine receptor 1 and 3 signaling pathway
|
|
Pathway Interaction Database
|
EPHB forward signalingreelinpathway:Reelin signaling pathwayerbb4_pathway:ErbB4 signaling events
|
|
Reelin signaling pathway
|
|
Reactome
|
COPII (Coat Protein 2) Mediated Vesicle Transport
|
|
Trafficking of AMPA receptors
|
|
Trafficking of GluR2-containing AMPA receptors
|
|
Unblocking of NMDA receptor, glutamate binding and activation
|
|
Cargo concentration in the ERR-HSA-3928662:EPHB-mediated forward signaling
|
|
CREB phosphorylation through the activation of CaMKII
|
|
Ras activation uopn Ca2+ infux through NMDA receptor
|
|
RAF/MAP kinase cascadeR-HSA-438066:Unblocking of NMDA receptor, glutamate binding and activation
|
|
RAF/MAP kinase cascadeR-HSA-3928662:EPHB-mediated forward signaling
|
|
RAF/MAP kinase cascade
|
|
WikiPathways
|
Neurotransmitter Receptor Binding And Downstream Transmission In The Postsynaptic CellWP666:Hypothetical Network for Drug Addiction
|
|
Neurotransmitter Receptor Binding And Downstream Transmission In The Postsynaptic Cell
|
|
Amyotrophic lateral sclerosis (ALS)
|
|
BDNF signaling pathwayWP706:SIDS Susceptibility Pathways
|
|
Hypothetical Network for Drug Addiction
|
|
Spinal Cord Injury
|
|
BDNF signaling pathway
|
|
Alzheimers DiseaseWP666:Hypothetical Network for Drug Addiction
|
| References |
| REF 1 | Trusted, scientifically sound profiles of drug programs, clinical trials, safety reports, and company deals, written by scientists. Springer. 2015. Adis Insight (drug id 800002155) |
|---|
| REF 2 | Bioorg Med Chem Lett. 2000 May 15;10(10):1133-7.4,10-Dihydro-4-oxo-4H-imidazo[1,2-a]indeno[1,2-e]pyrazin-2-carboxylic acid derivatives: highly potent and selective AMPA receptors antagonists with in vivo activity. |
|---|
| REF 3 | Bioorg Med Chem Lett. 2004 Oct 18;14(20):5107-11.Synthesis and AMPA receptor antagonistic activity of a novel 7-imidazolyl-6-trifluoromethyl quinoxalinecarboxylic acid with a substituted phenyl groupand improved its good physicochemical properties by introduced CF3 group. |
|---|
