| Drug General Information |
| Drug ID |
D02QAZ
|
| Former ID |
DNC008520
|
| Drug Name |
PF-228
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C22H20F3N5O3S
|
| Canonical SMILES |
CS(=O)(=O)C1=CC=CC(=C1)CNC2=NC(=NC=C2C(F)(F)F)NC3=CC4=C<br />(C=C3)NC(=O)CC4
|
| InChI |
1S/C22H20F3N5O3S/c1-34(32,33)16-4-2-3-13(9-16)11-26-20-17(22(23,24)25)12-27-21(30-20)28-15-6-7-18-14(10-15)5-8-19(31)29-18/h2-4,6-7,9-10,12H,5,8,11H2,1H3,(H,29,31)(H2,26,27,28,30)
|
| InChIKey |
HESLKTSGTIBHJU-UHFFFAOYSA-N
|
| PubChem Compound ID |
|
| Target and Pathway |
| Target(s) |
Cell division protein kinase 7 |
Target Info |
Inhibitor |
[1]
|
|---|
| Inhibitor of nuclear factor kappa B kinase beta subunit |
Target Info |
Inhibitor |
[1]
|
| Cell division protein kinase 2 |
Target Info |
Inhibitor |
[1]
|
| Focal adhesion kinase |
Target Info |
Inhibitor |
[1]
|
| Cell division control protein 2 homolog |
Target Info |
Inhibitor |
[1]
|
| Glycogen synthase kinase-3 beta |
Target Info |
Inhibitor |
[1]
|
|
KEGG Pathway
|
Basal transcription factors
|
|
Nucleotide excision repair
|
|
Cell cyclehsa04010:MAPK signaling pathway
|
|
Ras signaling pathway
|
|
Chemokine signaling pathway
|
|
NF-kappa B signaling pathway
|
|
FoxO signaling pathway
|
|
mTOR signaling pathway
|
|
PI3K-Akt signaling pathway
|
|
Apoptosis
|
|
Osteoclast differentiation
|
|
Toll-like receptor signaling pathway
|
|
NOD-like receptor signaling pathway
|
|
RIG-I-like receptor signaling pathway
|
|
Cytosolic DNA-sensing pathway
|
|
T cell receptor signaling pathway
|
|
B cell receptor signaling pathway
|
|
TNF signaling pathway
|
|
Neurotrophin signaling pathway
|
|
Insulin signaling pathway
|
|
Adipocytokine signaling pathway
|
|
Type II diabetes mellitus
|
|
Non-alcoholic fatty liver disease (NAFLD)
|
|
Epithelial cell signaling in Helicobacter pylori infection
|
|
Shigellosis
|
|
Chagas disease (American trypanosomiasis)
|
|
Toxoplasmosis
|
|
Hepatitis C
|
|
Hepatitis B
|
|
Influenza A
|
|
HTLV-I infection
|
|
Herpes simplex infection
|
|
Epstein-Barr virus infection
|
|
Pathways in cancer
|
|
MicroRNAs in cancer
|
|
Pancreatic cancer
|
|
Prostate cancer
|
|
Chronic myeloid leukemia
|
|
Acute myeloid leukemia
|
|
Small cell lung cancerhsa04068:FoxO signaling pathway
|
|
Cell cycle
|
|
Oocyte meiosis
|
|
p53 signaling pathway
|
|
Progesterone-mediated oocyte maturation
|
|
Measles
|
|
Viral carcinogenesis
|
|
Small cell lung cancerhsa04012:ErbB signaling pathway
|
|
Axon guidance
|
|
VEGF signaling pathway
|
|
Focal adhesion
|
|
Leukocyte transendothelial migration
|
|
Regulation of actin cytoskeleton
|
|
Bacterial invasion of epithelial cells
|
|
Amoebiasis
|
|
Transcriptional misregulation in cancer
|
|
Proteoglycans in cancer
|
|
Small cell lung cancerhsa04110:Cell cycle
|
|
Gap junction
|
|
Viral carcinogenesishsa04012:ErbB signaling pathway
|
|
Wnt signaling pathway
|
|
Hedgehog signaling pathway
|
|
Hippo signaling pathway
|
|
Signaling pathways regulating pluripotency of stem cells
|
|
Dopaminergic synapse
|
|
Melanogenesis
|
|
Prolactin signaling pathway
|
|
Thyroid hormone signaling pathway
|
|
Alzheimer's disease
|
|
Colorectal cancer
|
|
Endometrial cancer
|
|
Basal cell carcinoma
|
|
NetPath Pathway
|
TCR Signaling Pathway
|
|
RANKL Signaling PathwayNetPath_11:TCR Signaling PathwayNetPath_21:RANKL Signaling Pathway
|
|
PANTHER Pathway
|
Apoptosis signaling pathway
|
|
B cell activation
|
|
Inflammation mediated by chemokine and cytokine signaling pathway
|
|
Interleukin signaling pathway
|
|
PDGF signaling pathway
|
|
T cell activation
|
|
Toll receptor signaling pathwayP00059:p53 pathway
|
|
p53 pathway feedback loops 2P00005:Angiogenesis
|
|
Integrin signalling pathway
|
|
VEGF signaling pathway
|
|
CCKR signaling map STP00004:Alzheimer disease-presenilin pathway
|
|
Angiogenesis
|
|
Cadherin signaling pathway
|
|
Hedgehog signaling pathway
|
|
Heterotrimeric G-protein signaling pathway-Gi alpha and Gs alpha mediated pathway
|
|
Insulin/IGF pathway-protein kinase B signaling cascade
|
|
PI3 kinase pathway
|
|
Wnt signaling pathway
|
|
Ras Pathway
|
|
CCKR signaling map ST
|
|
Pathway Interaction Database
|
Retinoic acid receptors-mediated signalingfcer1pathway:Fc-epsilon receptor I signaling in mast cells
|
|
BCR signaling pathway
|
|
GMCSF-mediated signaling events
|
|
Atypical NF-kappaB pathway
|
|
TCR signaling in naï
|
|
Canonical NF-kappaB pathway
|
|
TRAIL signaling pathway
|
|
TCR signaling in naï
|
|
FAS (CD95) signaling pathway
|
|
IL1-mediated signaling events
|
|
mTOR signaling pathway
|
|
TNF receptor signaling pathway
|
|
FoxO family signaling
|
|
p75(NTR)-mediated signaling
|
|
Validated transcriptional targets of TAp63 isoforms
|
|
Endogenous TLR signalingsmad2_3nuclearpathway:Regulation of nuclear SMAD2/3 signaling
|
|
Signaling events mediated by PRL
|
|
p73 transcription factor network
|
|
E2F transcription factor network
|
|
ATR signaling pathway
|
|
IL2-mediated signaling events
|
|
FOXM1 transcription factor network
|
|
BARD1 signaling events
|
|
p53 pathway
|
|
Regulation of retinoblastoma proteinlysophospholipid_pathway:LPA receptor mediated events
|
|
CXCR4-mediated signaling eventsp73pathway:p73 transcription factor network
|
|
PLK1 signaling events
|
|
AP-1 transcription factor network
|
|
Retinoic acid receptors-mediated signalinglysophospholipid_pathway:LPA receptor mediated events
|
|
Degradation of beta catenin
|
|
Reelin signaling pathway
|
|
Presenilin action in Notch and Wnt signaling
|
|
Integrin-linked kinase signaling
|
|
CDC42 signaling events
|
|
LKB1 signaling events
|
|
Canonical Wnt signaling pathway
|
|
Role of Calcineurin-dependent NFAT signaling in lymphocytes
|
|
Glucocorticoid receptor regulatory network
|
|
C-MYC pathway
|
|
Regulation of Androgen receptor activity
|
|
BMP receptor signaling
|
|
Hedgehog signaling events mediated by Gli proteins
|
|
Signaling events mediated by Stem cell factor receptor (c-Kit)
|
|
Validated transcriptional targets of deltaNp63 isoforms
|
|
Aurora A signaling
|
|
Insulin-mediated glucose transport
|
|
Class I PI3K signaling events mediated by Akt
|
|
Trk receptor signaling mediated by PI3K and PLC-gamma
|
|
PathWhiz Pathway
|
Intracellular Signalling Through Adenosine Receptor A2a and Adenosine
|
|
Intracellular Signalling Through Adenosine Receptor A2b and Adenosine
|
|
Reactome
|
NoRC negatively regulates rRNA expression
|
|
Formation of TC-NER Pre-Incision Complex
|
|
Dual incision in TC-NER
|
|
Gap-filling DNA repair synthesis and ligation in TC-NER
|
|
Cyclin E associated events during G1/S transition
|
|
Cyclin D associated events in G1
|
|
Cyclin A/B1 associated events during G2/M transition
|
|
Cyclin A:Cdk2-associated events at S phase entry
|
|
RNA Polymerase I Transcription InitiationR-HSA-1169091:Activation of NF-kappaB in B cells
|
|
NOD1/2 Signaling Pathway
|
|
RIP-mediated NFkB activation via ZBP1
|
|
p75NTR recruits signalling complexes
|
|
NF-kB is activated and signals survival
|
|
FCERI mediated NF-kB activation
|
|
TAK1 activates NFkB by phosphorylation and activation of IKKs complex
|
|
Interleukin-1 signaling
|
|
Regulation of TNFR1 signaling
|
|
TNFR1-induced NFkappaB signaling pathway
|
|
IKBKB deficiency causes SCID
|
|
IKBKG deficiency causes anhidrotic ectodermal dysplasia with immunodeficiency (EDA-ID) (via TLR)
|
|
IkBA variant leads to EDA-ID
|
|
CLEC7A (Dectin-1) signaling
|
|
MAP3K8 (TPL2)-dependent MAPK1/3 activation
|
|
TRAF6 mediated NF-kB activation
|
|
NF-kB activation through FADD/RIP-1 pathway mediated by caspase-8 and -10
|
|
IRAK1 recruits IKK complex
|
|
IKK complex recruitment mediated by RIP1
|
|
IRAK1 recruits IKK complex upon TLR7/8 or 9 stimulationR-HSA-1538133:G0 and Early G1
|
|
Activation of ATR in response to replication stress
|
|
Regulation of APC/C activators between G1/S and early anaphase
|
|
SCF(Skp2)-mediated degradation of p27/p21
|
|
Senescence-Associated Secretory Phenotype (SASP)
|
|
DNA Damage/Telomere Stress Induced Senescence
|
|
Processing of DNA double-strand break ends
|
|
G2 Phase
|
|
Orc1 removal from chromatin
|
|
p53-Dependent G1 DNA Damage Response
|
|
Meiotic recombination
|
|
Factors involved in megakaryocyte development and platelet productionR-HSA-111465:Apoptotic cleavage of cellular proteins
|
|
Regulation of actin dynamics for phagocytic cup formation
|
|
Integrin alphaIIb beta3 signaling
|
|
GRB2:SOS provides linkage to MAPK signaling for Integrins
|
|
p130Cas linkage to MAPK signaling for integrins
|
|
NCAM signaling for neurite out-growth
|
|
Signal regulatory protein (SIRP) family interactions
|
|
EPHB-mediated forward signaling
|
|
EPHA-mediated growth cone collapse
|
|
DCC mediated attractive signaling
|
|
Netrin mediated repulsion signals
|
|
VEGFA-VEGFR2 Pathway
|
|
RHO GTPases Activate WASPs and WAVEs
|
|
RAF/MAP kinase cascadeR-HSA-110056:MAPK3 (ERK1) activation
|
|
E2F mediated regulation of DNA replication
|
|
G0 and Early G1
|
|
Cyclin B2 mediated events
|
|
Golgi Cisternae Pericentriolar Stack Reorganization
|
|
Cdc20:Phospho-APC/C mediated degradation of Cyclin A
|
|
Phosphorylation of the APC/C
|
|
Phosphorylation of Emi1
|
|
Condensation of Prophase Chromosomes
|
|
MASTL Facilitates Mitotic Progression
|
|
Resolution of Sister Chromatid Cohesion
|
|
Condensation of Prometaphase Chromosomes
|
|
Regulation of PLK1 Activity at G2/M Transition
|
|
Activation of NIMA Kinases NEK9, NEK6, NEK7
|
|
Loss of Nlp from mitotic centrosomes
|
|
Recruitment of mitotic centrosome proteins and complexes
|
|
Loss of proteins required for interphase microtubule organization?from the centrosome
|
|
Recruitment of NuMA to mitotic centrosomes
|
|
Depolymerisation of the Nuclear Lamina
|
|
Anchoring of the basal body to the plasma membrane
|
|
MAPK6/MAPK4 signaling
|
|
G1/S-Specific Transcription
|
|
G2/M DNA replication checkpoint
|
|
Chk1/Chk2(Cds1) mediated inactivation of Cyclin B:Cdk1 complexR-HSA-195253:Degradation of beta-catenin by the destruction complex
|
|
AKT phosphorylates targets in the cytosol
|
|
Regulation of HSF1-mediated heat shock response
|
|
CRMPs in Sema3A signaling
|
|
Disassembly of the destruction complex and recruitment of AXIN to the membrane
|
|
S33 mutants of beta-catenin aren't phosphorylated
|
|
S37 mutants of beta-catenin aren't phosphorylated
|
|
S45 mutants of beta-catenin aren't phosphorylated
|
|
T41 mutants of beta-catenin aren't phosphorylated
|
|
Degradation of GLI2 by the proteasome
|
|
Constitutive Signaling by AKT1 E17K in Cancer
|
|
WikiPathways
|
G1 to S cell cycle control
|
|
Eukaryotic Transcription Initiation
|
|
Cardiac Hypertrophic Response
|
|
S Phase
|
|
HIV Life Cycle
|
|
Integrated Breast Cancer Pathway
|
|
Nucleotide Excision Repair
|
|
RNA Polymerase II Transcription
|
|
RNA Polymerase I, RNA Polymerase III, and Mitochondrial Transcription
|
|
mRNA Capping
|
|
Mitotic G2-G2/M phases
|
|
Mitotic G1-G1/S phases
|
|
MicroRNAs in cardiomyocyte hypertrophyWP75:Toll-like receptor signaling pathway
|
|
Estrogen signaling pathway
|
|
TCR Signaling Pathway
|
|
Insulin Signaling
|
|
IL-4 Signaling Pathway
|
|
MAPK Signaling Pathway
|
|
NLR Proteins
|
|
Hair Follicle Development: Induction (Part 1 of 3)
|
|
MyD88 cascade initiated on plasma membrane
|
|
Cytosolic sensors of pathogen-associated DNA
|
|
MyD88 dependent cascade initiated on endosome
|
|
Nucleotide-binding domain, leucine rich repeat containing receptor (NLR) signaling pathways
|
|
MyD88:Mal cascade initiated on plasma membrane
|
|
Fc epsilon receptor (FCERI) signaling
|
|
MyD88-independent cascade
|
|
Signaling by the B Cell Receptor (BCR)
|
|
TAK1 activates NFkB by phosphorylation and activation of IKKs complex
|
|
Structural Pathway of Interleukin 1 (IL-1)
|
|
EBV LMP1 signaling
|
|
Polycystic Kidney Disease Pathway
|
|
Apoptosis
|
|
Quercetin and Nf-kB/ AP-1 Induced Cell Apoptosis
|
|
BDNF signaling pathway
|
|
Interleukin-11 Signaling Pathway
|
|
AGE/RAGE pathway
|
|
TNF alpha Signaling Pathway
|
|
B Cell Receptor Signaling Pathway
|
|
IL17 signaling pathway
|
|
TWEAK Signaling Pathway
|
|
Leptin signaling pathway
|
|
RANKL/RANK Signaling Pathway
|
|
Signalling by NGF
|
|
IL-1 signaling pathway
|
|
TCR signaling
|
|
RIG-I/MDA5 mediated induction of IFN-alpha/beta pathways
|
|
Interleukin-1 signaling
|
|
Apoptosis Modulation and Signaling
|
|
Type II diabetes mellitus
|
|
MicroRNAs in cardiomyocyte hypertrophy
|
|
Regulation of toll-like receptor signaling pathway
|
|
Osteopontin Signaling
|
|
NOD pathwayWP707:DNA Damage Response
|
|
ID signaling pathway
|
|
DNA Replication
|
|
M/G1 Transition
|
|
Meiotic Recombination
|
|
Aryl Hydrocarbon Receptor
|
|
ATM Signaling Pathway
|
|
Retinoblastoma (RB) in Cancer
|
|
Spinal Cord Injury
|
|
Integrated Pancreatic Cancer Pathway
|
|
Oncostatin M Signaling Pathway
|
|
Prostate Cancer
|
|
Signaling Pathways in Glioblastoma
|
|
TSH signaling pathway
|
|
Integrated Cancer pathway
|
|
Synthesis of DNA
|
|
Regulation of DNA replication
|
|
Factors involved in megakaryocyte development and platelet production
|
|
Cell Cycle
|
|
APC/C-mediated degradation of cell cycle proteins
|
|
Cell Cycle Checkpoints
|
|
miRNA Regulation of DNA Damage ResponseWP51:Regulation of Actin Cytoskeleton
|
|
EGF/EGFR Signaling Pathway
|
|
TGF beta Signaling Pathway
|
|
Signaling of Hepatocyte Growth Factor Receptor
|
|
Focal Adhesion
|
|
Apoptosis-related network due to altered Notch3 in ovarian cancer
|
|
Nanoparticle-mediated activation of receptor signaling
|
|
JAK/STAT
|
|
Primary Focal Segmental Glomerulosclerosis FSGS
|
|
Alpha 6 Beta 4 signaling pathway
|
|
Corticotropin-releasing hormone
|
|
Netrin-1 signaling
|
|
NCAM signaling for neurite out-growth
|
|
Integrin-mediated Cell Adhesion
|
|
Integrin alphaIIb beta3 signaling
|
|
Apoptotic execution phase
|
|
Angiogenesis
|
|
Androgen receptor signaling pathwayWP707:DNA Damage Response
|
|
PPAR Alpha Pathway
|
|
MAP kinase activation in TLR cascade
|
|
RAF/MAP kinase cascade
|
|
Mitotic Prophase
|
|
Mitotic Prometaphase
|
|
BMI1
|
|
Regulation of Microtubule Cytoskeleton
|
|
miRNA Regulation of DNA Damage ResponseWP710:DNA Damage Response (only ATM dependent)
|
|
Senescence and Autophagy in Cancer
|
|
Notch Signaling Pathway
|
|
Glycogen Metabolism
|
|
Wnt Signaling Pathway
|
|
Wnt Signaling Pathway and Pluripotency
|
|
IL-6 signaling pathway
|
|
Wnt Signaling Pathway Netpath
|
|
Copper homeostasis
|
|
Degradation of beta-catenin by the destruction complex
|
|
T-Cell Receptor and Co-stimulatory Signaling
|
|
Cardiac Progenitor Differentiation
|
|
Neural Crest Differentiation
|
|
Alzheimers Disease
|
|
IL-7 Signaling Pathway
|
|
Semaphorin interactions
|
|
Androgen receptor signaling pathway
|
|
IL-5 Signaling Pathway
|
| References |
| REF 1 | J Biol Chem. 2007 May 18;282(20):14845-52. Epub 2007 Mar 28.Cellular characterization of a novel focal adhesion kinase inhibitor. |
|---|
