| Drug General Information |
| Drug ID |
D01SHB
|
| Former ID |
DNC012515
|
| Drug Name |
TRANSTORINE
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C10H7NO3
|
| InChI |
InChI=1S/C10H7NO3/c12-9-5-8(10(13)14)11-7-4-2-1-3-6(7)9/h1-5H,(H,11,12)(H,13,14)
|
| InChIKey |
HCZHHEIFKROPDY-UHFFFAOYSA-N
|
| PubChem Compound ID |
|
| PubChem Substance ID |
4854, 107461, 3133514, 5665328, 7273480, 8138313, 8144530, 8149637, 8152433, 11111352, 11113415, 11335484, 11360723, 11364010, 11366572, 11369134, 11372299, 11374466, 11377296, 11461695, 11485259, 11489158, 11491205, 11492629, 11494930, 15091858, 15364517, 17405277, 22395914, 24277986, 26612028, 26679449, 26747099, 26747100, 26751656, 29201404, 29222963, 47365099, 47440154, 47515224, 47588903, 47662192, 48035008, 48035009, 48110362, 48259139, 48334395, 49747907, 50042585, 50104346
|
| Target and Pathway |
| Target(s) |
NMDA receptor subunit NR1 |
Target Info |
Inhibitor |
[2]
|
|---|
| Glutamate [NMDA] receptor subunit epsilon 2 |
Target Info |
Inhibitor |
[2]
|
| Glutamate [NMDA] receptor subunit epsilon 1 |
Target Info |
Inhibitor |
[2]
|
|
KEGG Pathway
|
Ras signaling pathway
|
|
Rap1 signaling pathway
|
|
Calcium signaling pathway
|
|
cAMP signaling pathway
|
|
Neuroactive ligand-receptor interaction
|
|
Circadian entrainment
|
|
Long-term potentiation
|
|
Glutamatergic synapse
|
|
Alzheimer's disease
|
|
Amyotrophic lateral sclerosis (ALS)
|
|
Huntington's disease
|
|
Cocaine addiction
|
|
Amphetamine addiction
|
|
Nicotine addiction
|
|
Alcoholismhsa04014:Ras signaling pathway
|
|
Dopaminergic synapse
|
|
Alcoholism
|
|
Systemic lupus erythematosushsa04014:Ras signaling pathway
|
|
Systemic lupus erythematosus
|
|
PANTHER Pathway
|
Huntington disease
|
|
Ionotropic glutamate receptor pathway
|
|
Metabotropic glutamate receptor group III pathway
|
|
Metabotropic glutamate receptor group I pathway
|
|
Muscarinic acetylcholine receptor 1 and 3 signaling pathwayP00029:Huntington disease
|
|
Muscarinic acetylcholine receptor 1 and 3 signaling pathway
|
|
Pathway Interaction Database
|
ErbB4 signaling events
|
|
Reelin signaling pathwayreelinpathway:Reelin signaling pathway
|
|
Reactome
|
EPHB-mediated forward signaling
|
|
Unblocking of NMDA receptor, glutamate binding and activation
|
|
CREB phosphorylation through the activation of CaMKII
|
|
Ras activation uopn Ca2+ infux through NMDA receptor
|
|
RAF/MAP kinase cascadeR-HSA-3928662:EPHB-mediated forward signaling
|
|
RAF/MAP kinase cascadeR-HSA-438066:Unblocking of NMDA receptor, glutamate binding and activation
|
|
RAF/MAP kinase cascade
|
|
WikiPathways
|
SIDS Susceptibility Pathways
|
|
Hypothetical Network for Drug Addiction
|
|
Neurotransmitter Receptor Binding And Downstream Transmission In The Postsynaptic Cell
|
|
Spinal Cord Injury
|
|
BDNF signaling pathway
|
|
Alzheimers DiseaseWP666:Hypothetical Network for Drug Addiction
|
|
BDNF signaling pathwayWP666:Hypothetical Network for Drug Addiction
|
|
Alzheimers Disease
|
| References |
| REF 1 | (http://www.guidetopharmacology.org/) Nucleic Acids Res. 2015 Oct 12. pii: gkv1037. The IUPHAR/BPS Guide to PHARMACOLOGY in 2016: towards curated quantitative interactions between 1300 protein targets and 6000 ligands. (Ligand id: 2918). |
|---|
| REF 2 | J Med Chem. 1990 Nov;33(11):2944-6.3-(2-carboxyindol-3-yl)propionic acid derivatives: antagonists of the strychnine-insensitive glycine receptor associated with the N-methyl-D-aspartate receptor complex. |
|---|
