| Drug General Information |
| Drug ID |
D00SEC
|
| Former ID |
DIB018805
|
| Drug Name |
aloisine
|
| Synonyms |
IN1538; RP106
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
|
| Formula |
C17H19N3O
|
| InChI |
InChI=1S/C17H19N3O/c1-3-4-5-14-15(12-6-8-13(21-2)9-7-12)20-17-16(14)18-10-11-19-17/h6-11H,3-5H2,1-2H3,(H,19,20)
|
| InChIKey |
WVMANZPBOBRWCB-UHFFFAOYSA-N
|
| PubChem Compound ID |
|
| PubChem Substance ID |
4963298, 9824244, 11108155, 16146302, 26758199, 37836728, 48095584, 51172427, 53800978, 57356450, 71750028, 85787192, 99302622, 103278247, 112073773, 162253865, 163122568, 163688629, 164835226, 175607455, 178102546, 179230463, 184600767, 196376753, 204380521, 208265184, 226458815, 244125054, 252451179
|
| Target and Pathway |
| Target(s) |
Zap70 tyrosine kinase |
Target Info |
Inhibitor |
[2]
|
|---|
| Focal adhesion kinase-2 |
Target Info |
Inhibitor |
[2]
|
| Cell division protein kinase 2 |
Target Info |
Inhibitor |
[2]
|
|
KEGG Pathway
|
Ras signaling pathway
|
|
NF-kappa B signaling pathway
|
|
Natural killer cell mediated cytotoxicity
|
|
T cell receptor signaling pathway
|
|
Primary immunodeficiencyhsa04020:Calcium signaling pathway
|
|
Chemokine signaling pathway
|
|
Leukocyte transendothelial migration
|
|
GnRH signaling pathway
|
|
Hepatitis Bhsa04068:FoxO signaling pathway
|
|
Cell cycle
|
|
Oocyte meiosis
|
|
p53 signaling pathway
|
|
PI3K-Akt signaling pathway
|
|
Progesterone-mediated oocyte maturation
|
|
Hepatitis B
|
|
Measles
|
|
Herpes simplex infection
|
|
Epstein-Barr virus infection
|
|
Pathways in cancer
|
|
Viral carcinogenesis
|
|
Prostate cancer
|
|
Small cell lung cancer
|
|
NetPath Pathway
|
TCR Signaling PathwayNetPath_11:TCR Signaling Pathway
|
|
PANTHER Pathway
|
T cell activationP00031:Inflammation mediated by chemokine and cytokine signaling pathway
|
|
Integrin signalling pathway
|
|
CCKR signaling map STP00059:p53 pathway
|
|
p53 pathway feedback loops 2
|
|
Pathway Interaction Database
|
TCR signaling in naï
|
|
TCR signaling in naï
|
|
Class I PI3K signaling eventsendothelinpathway:Endothelins
|
|
LPA receptor mediated events
|
|
Coregulation of Androgen receptor activity
|
|
Osteopontin-mediated events
|
|
IL2-mediated signaling events
|
|
CXCR4-mediated signaling events
|
|
Integrins in angiogenesis
|
|
Signaling events mediated by VEGFR1 and VEGFR2
|
|
Alpha-synuclein signaling
|
|
FGF signaling pathway
|
|
Alpha4 beta1 integrin signaling eventssmad2_3nuclearpathway:Regulation of nuclear SMAD2/3 signaling
|
|
Signaling events mediated by PRL
|
|
p73 transcription factor network
|
|
E2F transcription factor network
|
|
ATR signaling pathway
|
|
mTOR signaling pathway
|
|
FoxO family signaling
|
|
FOXM1 transcription factor network
|
|
BARD1 signaling events
|
|
p53 pathway
|
|
Regulation of retinoblastoma protein
|
|
Reactome
|
Translocation of ZAP-70 to Immunological synapse
|
|
Generation of second messenger moleculesR-HSA-391160:Signal regulatory protein (SIRP) family interactions
|
|
VEGFA-VEGFR2 Pathway
|
|
Interleukin-2 signalingR-HSA-1538133:G0 and Early G1
|
|
Activation of ATR in response to replication stress
|
|
Regulation of APC/C activators between G1/S and early anaphase
|
|
SCF(Skp2)-mediated degradation of p27/p21
|
|
Senescence-Associated Secretory Phenotype (SASP)
|
|
DNA Damage/Telomere Stress Induced Senescence
|
|
Processing of DNA double-strand break ends
|
|
G2 Phase
|
|
Orc1 removal from chromatin
|
|
Cyclin E associated events during G1/S transition
|
|
Cyclin A/B1 associated events during G2/M transition
|
|
p53-Dependent G1 DNA Damage Response
|
|
Cyclin A:Cdk2-associated events at S phase entry
|
|
Meiotic recombination
|
|
Factors involved in megakaryocyte development and platelet production
|
|
WikiPathways
|
TCR Signaling Pathway
|
|
Interferon type I signaling pathways
|
|
Inflammatory Response Pathway
|
|
JAK/STAT
|
|
T-Cell Receptor and Co-stimulatory Signaling
|
|
TCR signalingWP69:TCR Signaling Pathway
|
|
IL-2 Signaling Pathway
|
|
Signaling of Hepatocyte Growth Factor Receptor
|
|
Apoptosis-related network due to altered Notch3 in ovarian cancer
|
|
Interleukin-2 signaling
|
|
Nifedipine Activity
|
|
BDNF signaling pathway
|
|
Oncostatin M Signaling Pathway
|
|
Prostate Cancer
|
|
IL-7 Signaling Pathway
|
|
Signal regulatory protein (SIRP) family interactionsWP707:DNA Damage Response
|
|
ID signaling pathway
|
|
DNA Replication
|
|
G1 to S cell cycle control
|
|
M/G1 Transition
|
|
S Phase
|
|
Meiotic Recombination
|
|
Aryl Hydrocarbon Receptor
|
|
ATM Signaling Pathway
|
|
Retinoblastoma (RB) in Cancer
|
|
Spinal Cord Injury
|
|
Integrated Pancreatic Cancer Pathway
|
|
Signaling Pathways in Glioblastoma
|
|
TSH signaling pathway
|
|
Integrated Breast Cancer Pathway
|
|
Integrated Cancer pathway
|
|
Synthesis of DNA
|
|
Regulation of DNA replication
|
|
Mitotic G2-G2/M phases
|
|
Mitotic G1-G1/S phases
|
|
Factors involved in megakaryocyte development and platelet production
|
|
Cell Cycle
|
|
APC/C-mediated degradation of cell cycle proteins
|
|
Cell Cycle Checkpoints
|
|
miRNA Regulation of DNA Damage Response
|
| References |
| REF 1 | (http://www.guidetopharmacology.org/) Nucleic Acids Res. 2015 Oct 12. pii: gkv1037. The IUPHAR/BPS Guide to PHARMACOLOGY in 2016: towards curated quantitative interactions between 1300 protein targets and 6000 ligands. (Ligand id: 5923). |
|---|
| REF 2 | Identification of binding specificity-determining features in protein families. J Med Chem. 2012 Mar 8;55(5):1926-39. |
|---|
