| Drug General Information |
| Drug ID |
DXL2RA
|
| Drug Name |
(+)-(S)-3-(4-Nitrophenylamino)-3-(3-fluorophenyl)-1-p-tolylpropan-1-one
|
| Synonyms |
CHEMBL1164158
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Formula |
C22H19FN2O3
|
| Canonical SMILES |
Cc1ccc(cc1)C(=O)C[C@H](Nc2ccc(cc2)[N+](=O)[O-])c3cccc(F)c3
|
| InChI |
InChI=1S/C22H19FN2O3/c1-15-5-7-16(8-6-15)22(26)14-21(17-3-2-4-18(23)13-17)24-19-9-11-20(12-10-19)25(27)28/h2-13,21,24H,14H2,1H3/t21-/m0/s1
|
| InChIKey |
HQCVWNZJFCYZOD-NRFANRHFSA-N
|
| Target and Pathway |
| Target(s) |
Progesterone receptor |
Target Info |
|
[1]
|
|---|
| mRNA of androgen receptor |
Target Info |
|
[1]
|
|
KEGG Pathway
|
Oocyte meiosis
|
|
Progesterone-mediated oocyte maturationhsa04114:Oocyte meiosis
|
|
Pathways in cancer
|
|
Prostate cancer
|
|
NetPath Pathway
|
EGFR1 Signaling Pathway
|
|
AndrogenReceptor Signaling Pathway
|
|
FSH Signaling Pathway
|
|
Pathway Interaction Database
|
Cellular roles of Anthrax toxinsmad2_3nuclearpathway:Regulation of nuclear SMAD2/3 signaling
|
|
Coregulation of Androgen receptor activity
|
|
Regulation of Androgen receptor activity
|
|
Nongenotropic Androgen signaling
|
|
Regulation of nuclear beta catenin signaling and target gene transcription
|
|
FOXA1 transcription factor network
|
|
Notch-mediated HES/HEY network
|
|
Reactome
|
Nuclear signaling by ERBB4
|
|
Nuclear Receptor transcription pathwayR-HSA-383280:Nuclear Receptor transcription pathway
|
|
Activated PKN1 stimulates transcription of AR (androgen receptor) regulated genes KLK2 and KLK3
|
|
WikiPathways
|
Ovarian Infertility Genes
|
|
Signaling by ERBB4
|
|
Nuclear ReceptorsWP706:SIDS Susceptibility Pathways
|
|
Integrated Pancreatic Cancer Pathway
|
|
Prostate Cancer
|
|
Integrated Breast Cancer Pathway
|
|
Nuclear Receptors
|
|
Androgen receptor signaling pathway
|
| References |
| REF 1 | URL: https://www.ebi.ac.uk/chembl/ The ChEMBL database in 2017 |
|---|
